C9H10BrF2NO2S — CID 107611077
4-bromo-2,5-difluoro-N-(2-methylsulfonylethyl)aniline (PubChem CID 107611077) has the molecular formula C9H10BrF2NO2S and a molecular weight of 314.15 g/mol. Its IUPAC name is 4-bromo-2,5-difluoro-N-(2-methylsulfonylethyl)aniline.
| Compound Name | 4-bromo-2,5-difluoro-N-(2-methylsulfonylethyl)aniline |
|---|---|
| PubChem CID | 107611077 |
| Molecular Formula | C9H10BrF2NO2S |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | 4-bromo-2,5-difluoro-N-(2-methylsulfonylethyl)aniline |
| SMILES | CS(=O)(=O)CCNc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C9H10BrF2NO2S/c1-16(14,15)3-2-13-9-5-7(11)6(10)4-8(9)12/h4-5,13H,2-3H2,1H3 |
| InChIKey | GNALEKQHJFMKHG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|