C12H18BrNO3S — CID 114135739
N-(4-bromo-3,5-dimethylphenyl)-4-hydroxybutane-1-sulfonamide (PubChem CID 114135739) has the molecular formula C12H18BrNO3S and a molecular weight of 336.25 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-4-hydroxybutane-1-sulfonamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-4-hydroxybutane-1-sulfonamide |
|---|---|
| PubChem CID | 114135739 |
| Molecular Formula | C12H18BrNO3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-4-hydroxybutane-1-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)CCCCO)cc(C)c1Br |
| InChI | InChI=1S/C12H18BrNO3S/c1-9-7-11(8-10(2)12(9)13)14-18(16,17)6-4-3-5-15/h7-8,14-15H,3-6H2,1-2H3 |
| InChIKey | JHRZGSVXTJNNRQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|