C11H18N2O2S — CID 60909550
3-amino-N-(3,4-dimethylphenyl)propane-1-sulfonamide (PubChem CID 60909550) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 3-amino-N-(3,4-dimethylphenyl)propane-1-sulfonamide.
| Compound Name | 3-amino-N-(3,4-dimethylphenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 60909550 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-amino-N-(3,4-dimethylphenyl)propane-1-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)CCCN)cc1C |
| InChI | InChI=1S/C11H18N2O2S/c1-9-4-5-11(8-10(9)2)13-16(14,15)7-3-6-12/h4-5,8,13H,3,6-7,12H2,1-2H3 |
| InChIKey | GOJHVBQLHPSQAW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |