C11H18N2O3S — CID 54967740
3-amino-N-(3-ethoxyphenyl)propane-1-sulfonamide (PubChem CID 54967740) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-amino-N-(3-ethoxyphenyl)propane-1-sulfonamide.
| Compound Name | 3-amino-N-(3-ethoxyphenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 54967740 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-amino-N-(3-ethoxyphenyl)propane-1-sulfonamide |
| SMILES | CCOc1cccc(NS(=O)(=O)CCCN)c1 |
| InChI | InChI=1S/C11H18N2O3S/c1-2-16-11-6-3-5-10(9-11)13-17(14,15)8-4-7-12/h3,5-6,9,13H,2,4,7-8,12H2,1H3 |
| InChIKey | OWPVJLJDYOGBGG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |