C22H33N3O4S — CID 175293651
N,4-bis[3-(2-aminoethoxy)phenyl]hexane-1-sulfonamide (PubChem CID 175293651) has the molecular formula C22H33N3O4S and a molecular weight of 435.59 g/mol. Its IUPAC name is N,4-bis[3-(2-aminoethoxy)phenyl]hexane-1-sulfonamide.
| Compound Name | N,4-bis[3-(2-aminoethoxy)phenyl]hexane-1-sulfonamide |
|---|---|
| PubChem CID | 175293651 |
| Molecular Formula | C22H33N3O4S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N,4-bis[3-(2-aminoethoxy)phenyl]hexane-1-sulfonamide |
| SMILES | CCC(CCCS(=O)(=O)Nc1cccc(OCCN)c1)c1cccc(OCCN)c1 |
| InChI | InChI=1S/C22H33N3O4S/c1-2-18(19-6-3-9-21(16-19)28-13-11-23)7-5-15-30(26,27)25-20-8-4-10-22(17-20)29-14-12-24/h3-4,6,8-10,16-18,25H,2,5,7,11-15,23-24H2,1H3 |
| InChIKey | CLNHAJWSJFDFSD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |