C8H9F2NO3S — CID 79026481
N-(2,5-difluorophenyl)-2-hydroxyethanesulfonamide (PubChem CID 79026481) has the molecular formula C8H9F2NO3S and a molecular weight of 237.23 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-hydroxyethanesulfonamide.
| Compound Name | N-(2,5-difluorophenyl)-2-hydroxyethanesulfonamide |
|---|---|
| PubChem CID | 79026481 |
| Molecular Formula | C8H9F2NO3S |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-hydroxyethanesulfonamide |
| SMILES | O=S(=O)(CCO)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C8H9F2NO3S/c9-6-1-2-7(10)8(5-6)11-15(13,14)4-3-12/h1-2,5,11-12H,3-4H2 |
| InChIKey | SMLKWFILVMTWLR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |