C9H10F4N2O2S — CID 63037026
2-amino-N-[2-fluoro-5-(trifluoromethyl)phenyl]ethanesulfonamide (PubChem CID 63037026) has the molecular formula C9H10F4N2O2S and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-amino-N-[2-fluoro-5-(trifluoromethyl)phenyl]ethanesulfonamide.
| Compound Name | 2-amino-N-[2-fluoro-5-(trifluoromethyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 63037026 |
| Molecular Formula | C9H10F4N2O2S |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-amino-N-[2-fluoro-5-(trifluoromethyl)phenyl]ethanesulfonamide |
| SMILES | NCCS(=O)(=O)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C9H10F4N2O2S/c10-7-2-1-6(9(11,12)13)5-8(7)15-18(16,17)4-3-14/h1-2,5,15H,3-4,14H2 |
| InChIKey | AALIQVMQRIZZAU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |