C9H8Cl2F3NO2S — CID 113220712
2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]ethanesulfonamide (PubChem CID 113220712) has the molecular formula C9H8Cl2F3NO2S and a molecular weight of 322.14 g/mol. Its IUPAC name is 2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]ethanesulfonamide.
| Compound Name | 2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 113220712 |
| Molecular Formula | C9H8Cl2F3NO2S |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCCl)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C9H8Cl2F3NO2S/c10-3-4-18(16,17)15-8-5-6(9(12,13)14)1-2-7(8)11/h1-2,5,15H,3-4H2 |
| InChIKey | YTANHZOZMZDGPS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|