C15H13ClF3NO3S — CID 90518166
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenoxyethanesulfonamide (PubChem CID 90518166) has the molecular formula C15H13ClF3NO3S and a molecular weight of 379.79 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenoxyethanesulfonamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenoxyethanesulfonamide |
|---|---|
| PubChem CID | 90518166 |
| Molecular Formula | C15H13ClF3NO3S |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenoxyethanesulfonamide |
| SMILES | O=S(=O)(CCOc1ccccc1)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H13ClF3NO3S/c16-13-7-6-11(15(17,18)19)10-14(13)20-24(21,22)9-8-23-12-4-2-1-3-5-12/h1-7,10,20H,8-9H2 |
| InChIKey | UBJLUCLGQQISAP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |