C9H8BrClF3NO2S — CID 114043489
N-[2-bromo-5-(trifluoromethyl)phenyl]-2-chloroethanesulfonamide (PubChem CID 114043489) has the molecular formula C9H8BrClF3NO2S and a molecular weight of 366.59 g/mol. Its IUPAC name is N-[2-bromo-5-(trifluoromethyl)phenyl]-2-chloroethanesulfonamide.
| Compound Name | N-[2-bromo-5-(trifluoromethyl)phenyl]-2-chloroethanesulfonamide |
|---|---|
| PubChem CID | 114043489 |
| Molecular Formula | C9H8BrClF3NO2S |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 364.91 |
| IUPAC Name | N-[2-bromo-5-(trifluoromethyl)phenyl]-2-chloroethanesulfonamide |
| SMILES | O=S(=O)(CCCl)Nc1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C9H8BrClF3NO2S/c10-7-2-1-6(9(12,13)14)5-8(7)15-18(16,17)4-3-11/h1-2,5,15H,3-4H2 |
| InChIKey | CCHQGVFGHDIMBW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|