C10H12BrF3N2O2S — CID 106090013
1-amino-N-[2-bromo-5-(trifluoromethyl)phenyl]propane-2-sulfonamide (PubChem CID 106090013) has the molecular formula C10H12BrF3N2O2S and a molecular weight of 361.18 g/mol. Its IUPAC name is 1-amino-N-[2-bromo-5-(trifluoromethyl)phenyl]propane-2-sulfonamide.
| Compound Name | 1-amino-N-[2-bromo-5-(trifluoromethyl)phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 106090013 |
| Molecular Formula | C10H12BrF3N2O2S |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 1-amino-N-[2-bromo-5-(trifluoromethyl)phenyl]propane-2-sulfonamide |
| SMILES | CC(CN)S(=O)(=O)Nc1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C10H12BrF3N2O2S/c1-6(5-15)19(17,18)16-9-4-7(10(12,13)14)2-3-8(9)11/h2-4,6,16H,5,15H2,1H3 |
| InChIKey | BVSHIGRYGICUBX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |