C9H6BrF3N2O2S — CID 114042872
N-[2-bromo-5-(trifluoromethyl)phenyl]-1-cyanomethanesulfonamide (PubChem CID 114042872) has the molecular formula C9H6BrF3N2O2S and a molecular weight of 343.12 g/mol. Its IUPAC name is N-[2-bromo-5-(trifluoromethyl)phenyl]-1-cyanomethanesulfonamide.
| Compound Name | N-[2-bromo-5-(trifluoromethyl)phenyl]-1-cyanomethanesulfonamide |
|---|---|
| PubChem CID | 114042872 |
| Molecular Formula | C9H6BrF3N2O2S |
| Molecular Weight | 343.12 g/mol |
| Exact Mass | 341.93 |
| IUPAC Name | N-[2-bromo-5-(trifluoromethyl)phenyl]-1-cyanomethanesulfonamide |
| SMILES | N#CCS(=O)(=O)Nc1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C9H6BrF3N2O2S/c10-7-2-1-6(9(11,12)13)5-8(7)15-18(16,17)4-3-14/h1-2,5,15H,4H2 |
| InChIKey | BHNDLGWCTBGXGE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.12 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |