C11H10ClF3N2O2S — CID 115911470
3-chloro-N-[2-cyano-4-(trifluoromethyl)phenyl]propane-1-sulfonamide (PubChem CID 115911470) has the molecular formula C11H10ClF3N2O2S and a molecular weight of 326.73 g/mol. Its IUPAC name is 3-chloro-N-[2-cyano-4-(trifluoromethyl)phenyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[2-cyano-4-(trifluoromethyl)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 115911470 |
| Molecular Formula | C11H10ClF3N2O2S |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 3-chloro-N-[2-cyano-4-(trifluoromethyl)phenyl]propane-1-sulfonamide |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1NS(=O)(=O)CCCCl |
| InChI | InChI=1S/C11H10ClF3N2O2S/c12-4-1-5-20(18,19)17-10-3-2-9(11(13,14)15)6-8(10)7-16/h2-3,6,17H,1,4-5H2 |
| InChIKey | TXEQBTNORHNBPD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|