C16H19NO5S — CID 90518196
N-(3,5-dimethoxyphenyl)-2-phenoxyethanesulfonamide (PubChem CID 90518196) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-phenoxyethanesulfonamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-phenoxyethanesulfonamide |
|---|---|
| PubChem CID | 90518196 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-phenoxyethanesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)CCOc2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C16H19NO5S/c1-20-15-10-13(11-16(12-15)21-2)17-23(18,19)9-8-22-14-6-4-3-5-7-14/h3-7,10-12,17H,8-9H2,1-2H3 |
| InChIKey | CCGSFBUUWLJKSG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |