C11H7ClF3NO2S2 — CID 971753
N-[2-chloro-5-(trifluoromethyl)phenyl]thiophene-2-sulfonamide (PubChem CID 971753) has the molecular formula C11H7ClF3NO2S2 and a molecular weight of 341.76 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 971753 |
| Molecular Formula | C11H7ClF3NO2S2 |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(C(F)(F)F)ccc1Cl)c1cccs1 |
| InChI | InChI=1S/C11H7ClF3NO2S2/c12-8-4-3-7(11(13,14)15)6-9(8)16-20(17,18)10-2-1-5-19-10/h1-6,16H |
| InChIKey | LKANVMMIVMKKDG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |