C11H15F3N2O2S — CID 16774838
N-[2-amino-4-(trifluoromethyl)phenyl]butane-1-sulfonamide (PubChem CID 16774838) has the molecular formula C11H15F3N2O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is N-[2-amino-4-(trifluoromethyl)phenyl]butane-1-sulfonamide.
| Compound Name | N-[2-amino-4-(trifluoromethyl)phenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 16774838 |
| Molecular Formula | C11H15F3N2O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-[2-amino-4-(trifluoromethyl)phenyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C11H15F3N2O2S/c1-2-3-6-19(17,18)16-10-5-4-8(7-9(10)15)11(12,13)14/h4-5,7,16H,2-3,6,15H2,1H3 |
| InChIKey | HXYSYYFRLAHDKN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|