C10H11F3N2O4S — CID 60640770
N-[2-nitro-4-(trifluoromethyl)phenyl]propane-1-sulfonamide (PubChem CID 60640770) has the molecular formula C10H11F3N2O4S and a molecular weight of 312.27 g/mol. Its IUPAC name is N-[2-nitro-4-(trifluoromethyl)phenyl]propane-1-sulfonamide.
| Compound Name | N-[2-nitro-4-(trifluoromethyl)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 60640770 |
| Molecular Formula | C10H11F3N2O4S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | N-[2-nitro-4-(trifluoromethyl)phenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11F3N2O4S/c1-2-5-20(18,19)14-8-4-3-7(10(11,12)13)6-9(8)15(16)17/h3-4,6,14H,2,5H2,1H3 |
| InChIKey | YMJOUHKCMNNTFC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|