C12H15F3N2O5S — CID 86602208
2-[2-nitro-4-(trifluoromethyl)anilino]butyl methanesulfonate (PubChem CID 86602208) has the molecular formula C12H15F3N2O5S and a molecular weight of 356.32 g/mol. Its IUPAC name is 2-[2-nitro-4-(trifluoromethyl)anilino]butyl methanesulfonate.
| Compound Name | 2-[2-nitro-4-(trifluoromethyl)anilino]butyl methanesulfonate |
|---|---|
| PubChem CID | 86602208 |
| Molecular Formula | C12H15F3N2O5S |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[2-nitro-4-(trifluoromethyl)anilino]butyl methanesulfonate |
| SMILES | CCC(COS(C)(=O)=O)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15F3N2O5S/c1-3-9(7-22-23(2,20)21)16-10-5-4-8(12(13,14)15)6-11(10)17(18)19/h4-6,9,16H,3,7H2,1-2H3 |
| InChIKey | AFAVSDJUIPTETH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|