C10H8F3N2O5- — CID 7115950
(2S)-3-hydroxy-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate (PubChem CID 7115950) has the molecular formula C10H8F3N2O5- and a molecular weight of 293.18 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate.
| Compound Name | (2S)-3-hydroxy-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 7115950 |
| Molecular Formula | C10H8F3N2O5- |
| Molecular Weight | 293.18 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (2S)-3-hydroxy-2-[2-nitro-4-(trifluoromethyl)anilino]propanoate |
| SMILES | O=C([O-])[C@H](CO)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9F3N2O5/c11-10(12,13)5-1-2-6(8(3-5)15(19)20)14-7(4-16)9(17)18/h1-3,7,14,16H,4H2,(H,17,18)/p-1/t7-/m0/s1 |
| InChIKey | NKPDNJKBGFEIEO-ZETCQYMHSA-M |
| XLogP | 0.14 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.18 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|