C19H21F3N2O5S — CID 87891543
[(2R)-2-[N-benzyl-2-nitro-4-(trifluoromethyl)anilino]butyl] methanesulfonate (PubChem CID 87891543) has the molecular formula C19H21F3N2O5S and a molecular weight of 446.45 g/mol. Its IUPAC name is [(2R)-2-[N-benzyl-2-nitro-4-(trifluoromethyl)anilino]butyl] methanesulfonate.
| Compound Name | [(2R)-2-[N-benzyl-2-nitro-4-(trifluoromethyl)anilino]butyl] methanesulfonate |
|---|---|
| PubChem CID | 87891543 |
| Molecular Formula | C19H21F3N2O5S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | [(2R)-2-[N-benzyl-2-nitro-4-(trifluoromethyl)anilino]butyl] methanesulfonate |
| SMILES | CC[C@H](COS(C)(=O)=O)N(Cc1ccccc1)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21F3N2O5S/c1-3-16(13-29-30(2,27)28)23(12-14-7-5-4-6-8-14)17-10-9-15(19(20,21)22)11-18(17)24(25)26/h4-11,16H,3,12-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | JVJKUYHIFNDIJW-MRXNPFEDSA-N |
| XLogP | 4.38 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|