C24H19F6N3O6S — CID 44523557
N,1-bis[2-nitro-4-(trifluoromethyl)phenyl]-1-phenyl-N-propylmethanesulfonamide (PubChem CID 44523557) has the molecular formula C24H19F6N3O6S and a molecular weight of 591.49 g/mol. Its IUPAC name is N,1-bis[2-nitro-4-(trifluoromethyl)phenyl]-1-phenyl-N-propylmethanesulfonamide.
| Compound Name | N,1-bis[2-nitro-4-(trifluoromethyl)phenyl]-1-phenyl-N-propylmethanesulfonamide |
|---|---|
| PubChem CID | 44523557 |
| Molecular Formula | C24H19F6N3O6S |
| Molecular Weight | 591.49 g/mol |
| Exact Mass | 591.09 |
| IUPAC Name | N,1-bis[2-nitro-4-(trifluoromethyl)phenyl]-1-phenyl-N-propylmethanesulfonamide |
| SMILES | CCCN(c1ccc(C(F)(F)F)cc1[N+](=O)[O-])S(=O)(=O)C(c1ccccc1)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H19F6N3O6S/c1-2-12-31(19-11-9-17(24(28,29)30)14-21(19)33(36)37)40(38,39)22(15-6-4-3-5-7-15)18-10-8-16(23(25,26)27)13-20(18)32(34)35/h3-11,13-14,22H,2,12H2,1H3 |
| InChIKey | ONXILTINTKXFLA-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|