C12H13F3N2O4 — CID 62818914
2-methyl-2-[N-methyl-2-nitro-4-(trifluoromethyl)anilino]propanoic acid (PubChem CID 62818914) has the molecular formula C12H13F3N2O4 and a molecular weight of 306.24 g/mol. Its IUPAC name is 2-methyl-2-[N-methyl-2-nitro-4-(trifluoromethyl)anilino]propanoic acid.
| Compound Name | 2-methyl-2-[N-methyl-2-nitro-4-(trifluoromethyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 62818914 |
| Molecular Formula | C12H13F3N2O4 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-methyl-2-[N-methyl-2-nitro-4-(trifluoromethyl)anilino]propanoic acid |
| SMILES | CN(c1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H13F3N2O4/c1-11(2,10(18)19)16(3)8-5-4-7(12(13,14)15)6-9(8)17(20)21/h4-6H,1-3H3,(H,18,19) |
| InChIKey | YLPMOUDJJZDDIL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|