C13H14F3NO3 — CID 63198876
3,3-dimethyl-1-[2-nitro-4-(trifluoromethyl)phenyl]butan-2-one (PubChem CID 63198876) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is 3,3-dimethyl-1-[2-nitro-4-(trifluoromethyl)phenyl]butan-2-one.
| Compound Name | 3,3-dimethyl-1-[2-nitro-4-(trifluoromethyl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 63198876 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3,3-dimethyl-1-[2-nitro-4-(trifluoromethyl)phenyl]butan-2-one |
| SMILES | CC(C)(C)C(=O)Cc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14F3NO3/c1-12(2,3)11(18)6-8-4-5-9(13(14,15)16)7-10(8)17(19)20/h4-5,7H,6H2,1-3H3 |
| InChIKey | UQQGWWRCSTXZGB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|