C13H15F3N2O4 — CID 18509880
[2-methyl-2-[2-nitro-4-(trifluoromethyl)anilino]propyl] acetate (PubChem CID 18509880) has the molecular formula C13H15F3N2O4 and a molecular weight of 320.27 g/mol. Its IUPAC name is [2-methyl-2-[2-nitro-4-(trifluoromethyl)anilino]propyl] acetate.
| Compound Name | [2-methyl-2-[2-nitro-4-(trifluoromethyl)anilino]propyl] acetate |
|---|---|
| PubChem CID | 18509880 |
| Molecular Formula | C13H15F3N2O4 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [2-methyl-2-[2-nitro-4-(trifluoromethyl)anilino]propyl] acetate |
| SMILES | CC(=O)OCC(C)(C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15F3N2O4/c1-8(19)22-7-12(2,3)17-10-5-4-9(13(14,15)16)6-11(10)18(20)21/h4-6,17H,7H2,1-3H3 |
| InChIKey | SACNGWSSKGTVCA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|