C22H19F3N2O6 — CID 2799180
[3-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]butyl] 2-oxochromene-3-carboxylate (PubChem CID 2799180) has the molecular formula C22H19F3N2O6 and a molecular weight of 464.40 g/mol. Its IUPAC name is [3-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]butyl] 2-oxochromene-3-carboxylate.
| Compound Name | [3-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]butyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 2799180 |
| Molecular Formula | C22H19F3N2O6 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | [3-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]butyl] 2-oxochromene-3-carboxylate |
| SMILES | CC(C)(CCOC(=O)c1cc2ccccc2oc1=O)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19F3N2O6/c1-21(2,26-16-8-7-14(22(23,24)25)12-17(16)27(30)31)9-10-32-19(28)15-11-13-5-3-4-6-18(13)33-20(15)29/h3-8,11-12,26H,9-10H2,1-2H3 |
| InChIKey | ATJBRJBZUFDHAF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|