C20H15F3N2O6 — CID 40778123
[(2R)-1-[2-nitro-4-(trifluoromethyl)anilino]propan-2-yl] 2-oxochromene-3-carboxylate (PubChem CID 40778123) has the molecular formula C20H15F3N2O6 and a molecular weight of 436.34 g/mol. Its IUPAC name is [(2R)-1-[2-nitro-4-(trifluoromethyl)anilino]propan-2-yl] 2-oxochromene-3-carboxylate.
| Compound Name | [(2R)-1-[2-nitro-4-(trifluoromethyl)anilino]propan-2-yl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 40778123 |
| Molecular Formula | C20H15F3N2O6 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | [(2R)-1-[2-nitro-4-(trifluoromethyl)anilino]propan-2-yl] 2-oxochromene-3-carboxylate |
| SMILES | C[C@H](CNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])OC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C20H15F3N2O6/c1-11(10-24-15-7-6-13(20(21,22)23)9-16(15)25(28)29)30-18(26)14-8-12-4-2-3-5-17(12)31-19(14)27/h2-9,11,24H,10H2,1H3/t11-/m1/s1 |
| InChIKey | IELAZIIBJQYEDD-LLVKDONJSA-N |
| XLogP | 4.38 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|