C20H14F3NO5 — CID 7785575
[(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-oxochromene-3-carboxylate (PubChem CID 7785575) has the molecular formula C20H14F3NO5 and a molecular weight of 405.33 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-oxochromene-3-carboxylate.
| Compound Name | [(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 7785575 |
| Molecular Formula | C20H14F3NO5 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [(2R)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] 2-oxochromene-3-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cc2ccccc2oc1=O)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H14F3NO5/c1-11(17(25)24-14-8-6-13(7-9-14)20(21,22)23)28-18(26)15-10-12-4-2-3-5-16(12)29-19(15)27/h2-11H,1H3,(H,24,25)/t11-/m1/s1 |
| InChIKey | NCQPICGHMJGLBK-LLVKDONJSA-N |
| XLogP | 4.00 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|