C20H17NO5 — CID 7193579
[(2S)-1-(4-acetylanilino)-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate (PubChem CID 7193579) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is [(2S)-1-(4-acetylanilino)-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate.
| Compound Name | [(2S)-1-(4-acetylanilino)-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7193579 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [(2S)-1-(4-acetylanilino)-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate |
| SMILES | CC(=O)c1ccc(NC(=O)[C@H](C)OC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C20H17NO5/c1-12(22)14-7-9-16(10-8-14)21-19(23)13(2)25-20(24)18-11-15-5-3-4-6-17(15)26-18/h3-11,13H,1-2H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | VUFSLFHCDAFUGG-ZDUSSCGKSA-N |
| XLogP | 3.82 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |