C22H17NO4 — CID 16503015
[1-(naphthalen-1-ylamino)-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate (PubChem CID 16503015) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is [1-(naphthalen-1-ylamino)-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate.
| Compound Name | [1-(naphthalen-1-ylamino)-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16503015 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | [1-(naphthalen-1-ylamino)-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate |
| SMILES | CC(OC(=O)c1cc2ccccc2o1)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H17NO4/c1-14(26-22(25)20-13-16-8-3-5-12-19(16)27-20)21(24)23-18-11-6-9-15-7-2-4-10-17(15)18/h2-14H,1H3,(H,23,24) |
| InChIKey | LUPYAMVROPSNSC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |