C17H16F3N3O7 — CID 2799181
[3-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]butyl] 5-nitrofuran-2-carboxylate (PubChem CID 2799181) has the molecular formula C17H16F3N3O7 and a molecular weight of 431.32 g/mol. Its IUPAC name is [3-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]butyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [3-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]butyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2799181 |
| Molecular Formula | C17H16F3N3O7 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | [3-methyl-3-[2-nitro-4-(trifluoromethyl)anilino]butyl] 5-nitrofuran-2-carboxylate |
| SMILES | CC(C)(CCOC(=O)c1ccc([N+](=O)[O-])o1)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16F3N3O7/c1-16(2,7-8-29-15(24)13-5-6-14(30-13)23(27)28)21-11-4-3-10(17(18,19)20)9-12(11)22(25)26/h3-6,9,21H,7-8H2,1-2H3 |
| InChIKey | WBTUKOWJKCEWRR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 137.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|