C13H9F3N2O4 — CID 145293615
N-[2-methyl-5-(trifluoromethyl)phenyl]-5-nitrofuran-2-carboxamide (PubChem CID 145293615) has the molecular formula C13H9F3N2O4 and a molecular weight of 314.22 g/mol. Its IUPAC name is N-[2-methyl-5-(trifluoromethyl)phenyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[2-methyl-5-(trifluoromethyl)phenyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 145293615 |
| Molecular Formula | C13H9F3N2O4 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | N-[2-methyl-5-(trifluoromethyl)phenyl]-5-nitrofuran-2-carboxamide |
| SMILES | Cc1ccc(C(F)(F)F)cc1NC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C13H9F3N2O4/c1-7-2-3-8(13(14,15)16)6-9(7)17-12(19)10-4-5-11(22-10)18(20)21/h2-6H,1H3,(H,17,19) |
| InChIKey | YPUQVQBSCUHVON-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|