C14H8F3N5O4 — CID 24981296
5-nitro-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 24981296) has the molecular formula C14H8F3N5O4 and a molecular weight of 367.24 g/mol. Its IUPAC name is 5-nitro-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-nitro-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24981296 |
| Molecular Formula | C14H8F3N5O4 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 5-nitro-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1-n1cncn1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C14H8F3N5O4/c15-14(16,17)8-1-2-10(21-7-18-6-19-21)9(5-8)20-13(23)11-3-4-12(26-11)22(24)25/h1-7H,(H,20,23) |
| InChIKey | XSQXONUTQFARKT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|