C15H9ClN6O5 — CID 55337238
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3,5-dinitrobenzamide (PubChem CID 55337238) has the molecular formula C15H9ClN6O5 and a molecular weight of 388.73 g/mol. Its IUPAC name is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 55337238 |
| Molecular Formula | C15H9ClN6O5 |
| Molecular Weight | 388.73 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1-n1cncn1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H9ClN6O5/c16-10-1-2-14(20-8-17-7-18-20)13(5-10)19-15(23)9-3-11(21(24)25)6-12(4-9)22(26)27/h1-8H,(H,19,23) |
| InChIKey | VLFPHBWYYHBXSR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 146.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.73 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|