C14H8Cl3N5O — CID 31402196
3,6-dichloro-N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]pyridine-2-carboxamide (PubChem CID 31402196) has the molecular formula C14H8Cl3N5O and a molecular weight of 368.61 g/mol. Its IUPAC name is 3,6-dichloro-N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 31402196 |
| Molecular Formula | C14H8Cl3N5O |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 3,6-dichloro-N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1-n1cncn1)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H8Cl3N5O/c15-8-1-3-11(22-7-18-6-19-22)10(5-8)20-14(23)13-9(16)2-4-12(17)21-13/h1-7H,(H,20,23) |
| InChIKey | SMJOQVBACUCIRM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|