C19H19ClN6O3 — CID 25494519
N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-[methyl-[(1S)-1-(3-nitrophenyl)ethyl]amino]acetamide (PubChem CID 25494519) has the molecular formula C19H19ClN6O3 and a molecular weight of 414.85 g/mol. Its IUPAC name is N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-[methyl-[(1S)-1-(3-nitrophenyl)ethyl]amino]acetamide.
| Compound Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-[methyl-[(1S)-1-(3-nitrophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 25494519 |
| Molecular Formula | C19H19ClN6O3 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]-2-[methyl-[(1S)-1-(3-nitrophenyl)ethyl]amino]acetamide |
| SMILES | C[C@@H](c1cccc([N+](=O)[O-])c1)N(C)CC(=O)Nc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C19H19ClN6O3/c1-13(14-4-3-5-16(8-14)26(28)29)24(2)10-19(27)23-17-9-15(20)6-7-18(17)25-12-21-11-22-25/h3-9,11-13H,10H2,1-2H3,(H,23,27)/t13-/m0/s1 |
| InChIKey | YPPBQVQRBIGIGD-ZDUSSCGKSA-N |
| XLogP | 3.46 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|