C14H16N4O4 — CID 42937133
2-[methyl-[1-(3-nitrophenyl)ethyl]amino]-N-(1,2-oxazol-3-yl)acetamide (PubChem CID 42937133) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-[methyl-[1-(3-nitrophenyl)ethyl]amino]-N-(1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[methyl-[1-(3-nitrophenyl)ethyl]amino]-N-(1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 42937133 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[methyl-[1-(3-nitrophenyl)ethyl]amino]-N-(1,2-oxazol-3-yl)acetamide |
| SMILES | CC(c1cccc([N+](=O)[O-])c1)N(C)CC(=O)Nc1ccon1 |
| InChI | InChI=1S/C14H16N4O4/c1-10(11-4-3-5-12(8-11)18(20)21)17(2)9-14(19)15-13-6-7-22-16-13/h3-8,10H,9H2,1-2H3,(H,15,16,19) |
| InChIKey | FHQXATGJXMHQDL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|