C24H26N4O5 — CID 51556441
2-[furan-2-ylmethyl-[2-[methyl-[(1R)-1-(3-nitrophenyl)ethyl]amino]acetyl]amino]-N-phenylacetamide (PubChem CID 51556441) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-[furan-2-ylmethyl-[2-[methyl-[(1R)-1-(3-nitrophenyl)ethyl]amino]acetyl]amino]-N-phenylacetamide.
| Compound Name | 2-[furan-2-ylmethyl-[2-[methyl-[(1R)-1-(3-nitrophenyl)ethyl]amino]acetyl]amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 51556441 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2-[furan-2-ylmethyl-[2-[methyl-[(1R)-1-(3-nitrophenyl)ethyl]amino]acetyl]amino]-N-phenylacetamide |
| SMILES | C[C@H](c1cccc([N+](=O)[O-])c1)N(C)CC(=O)N(CC(=O)Nc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C24H26N4O5/c1-18(19-8-6-11-21(14-19)28(31)32)26(2)17-24(30)27(15-22-12-7-13-33-22)16-23(29)25-20-9-4-3-5-10-20/h3-14,18H,15-17H2,1-2H3,(H,25,29)/t18-/m1/s1 |
| InChIKey | HXFNQDYKTFQQHQ-GOSISDBHSA-N |
| XLogP | 3.85 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|