C18H20F3N3O4 — CID 47011175
N-(furan-2-ylmethyl)-2-[methyl-[1-(3-nitrophenyl)ethyl]amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 47011175) has the molecular formula C18H20F3N3O4 and a molecular weight of 399.37 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[methyl-[1-(3-nitrophenyl)ethyl]amino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[methyl-[1-(3-nitrophenyl)ethyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 47011175 |
| Molecular Formula | C18H20F3N3O4 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[methyl-[1-(3-nitrophenyl)ethyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CC(c1cccc([N+](=O)[O-])c1)N(C)CC(=O)N(Cc1ccco1)CC(F)(F)F |
| InChI | InChI=1S/C18H20F3N3O4/c1-13(14-5-3-6-15(9-14)24(26)27)22(2)11-17(25)23(12-18(19,20)21)10-16-7-4-8-28-16/h3-9,13H,10-12H2,1-2H3 |
| InChIKey | QYURXZZJNIILIQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|