C11H13ClF3NO2 — CID 62728690
3-chloro-N-(furan-2-ylmethyl)-2-methyl-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 62728690) has the molecular formula C11H13ClF3NO2 and a molecular weight of 283.68 g/mol. Its IUPAC name is 3-chloro-N-(furan-2-ylmethyl)-2-methyl-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 3-chloro-N-(furan-2-ylmethyl)-2-methyl-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 62728690 |
| Molecular Formula | C11H13ClF3NO2 |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-chloro-N-(furan-2-ylmethyl)-2-methyl-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(CCl)C(=O)N(Cc1ccco1)CC(F)(F)F |
| InChI | InChI=1S/C11H13ClF3NO2/c1-8(5-12)10(17)16(7-11(13,14)15)6-9-3-2-4-18-9/h2-4,8H,5-7H2,1H3 |
| InChIKey | OYPBWLXJCHYGQL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|