C14H20ClF2NO2 — CID 167884453
2-chloro-N-(3,3-difluoro-2,2-dimethylpentyl)-N-(furan-2-ylmethyl)acetamide (PubChem CID 167884453) has the molecular formula C14H20ClF2NO2 and a molecular weight of 307.77 g/mol. Its IUPAC name is 2-chloro-N-(3,3-difluoro-2,2-dimethylpentyl)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-chloro-N-(3,3-difluoro-2,2-dimethylpentyl)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 167884453 |
| Molecular Formula | C14H20ClF2NO2 |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-chloro-N-(3,3-difluoro-2,2-dimethylpentyl)-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCC(F)(F)C(C)(C)CN(Cc1ccco1)C(=O)CCl |
| InChI | InChI=1S/C14H20ClF2NO2/c1-4-14(16,17)13(2,3)10-18(12(19)8-15)9-11-6-5-7-20-11/h5-7H,4,8-10H2,1-3H3 |
| InChIKey | WUUBCRGADIPEHA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|