C25H26FN5O3 — CID 55432255
N-[3-cyano-1-[(4-fluorophenyl)methyl]-4,5-dimethylpyrrol-2-yl]-2-[methyl-[1-(3-nitrophenyl)ethyl]amino]acetamide (PubChem CID 55432255) has the molecular formula C25H26FN5O3 and a molecular weight of 463.51 g/mol. Its IUPAC name is N-[3-cyano-1-[(4-fluorophenyl)methyl]-4,5-dimethylpyrrol-2-yl]-2-[methyl-[1-(3-nitrophenyl)ethyl]amino]acetamide.
| Compound Name | N-[3-cyano-1-[(4-fluorophenyl)methyl]-4,5-dimethylpyrrol-2-yl]-2-[methyl-[1-(3-nitrophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 55432255 |
| Molecular Formula | C25H26FN5O3 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | N-[3-cyano-1-[(4-fluorophenyl)methyl]-4,5-dimethylpyrrol-2-yl]-2-[methyl-[1-(3-nitrophenyl)ethyl]amino]acetamide |
| SMILES | Cc1c(C#N)c(NC(=O)CN(C)C(C)c2cccc([N+](=O)[O-])c2)n(Cc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C25H26FN5O3/c1-16-17(2)30(14-19-8-10-21(26)11-9-19)25(23(16)13-27)28-24(32)15-29(4)18(3)20-6-5-7-22(12-20)31(33)34/h5-12,18H,14-15H2,1-4H3,(H,28,32) |
| InChIKey | SSBXGTPFXZVCSF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|