C26H27FN6O3 — CID 26299435
N-[3-cyano-1-[(4-fluorophenyl)methyl]-4,5-dimethylpyrrol-2-yl]-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide (PubChem CID 26299435) has the molecular formula C26H27FN6O3 and a molecular weight of 490.54 g/mol. Its IUPAC name is N-[3-cyano-1-[(4-fluorophenyl)methyl]-4,5-dimethylpyrrol-2-yl]-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[3-cyano-1-[(4-fluorophenyl)methyl]-4,5-dimethylpyrrol-2-yl]-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 26299435 |
| Molecular Formula | C26H27FN6O3 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | N-[3-cyano-1-[(4-fluorophenyl)methyl]-4,5-dimethylpyrrol-2-yl]-2-[4-(4-nitrophenyl)piperazin-1-yl]acetamide |
| SMILES | Cc1c(C#N)c(NC(=O)CN2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n(Cc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C26H27FN6O3/c1-18-19(2)32(16-20-3-5-21(27)6-4-20)26(24(18)15-28)29-25(34)17-30-11-13-31(14-12-30)22-7-9-23(10-8-22)33(35)36/h3-10H,11-14,16-17H2,1-2H3,(H,29,34) |
| InChIKey | GOLOBNNHYCAFCX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|