C26H28N6O3 — CID 24506718
N-(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide (PubChem CID 24506718) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is N-(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 24506718 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | N-(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide |
| SMILES | Cc1c(C#N)c(NC(=O)CN2CCN(c3ccccc3[N+](=O)[O-])CC2)n(Cc2ccccc2)c1C |
| InChI | InChI=1S/C26H28N6O3/c1-19-20(2)31(17-21-8-4-3-5-9-21)26(22(19)16-27)28-25(33)18-29-12-14-30(15-13-29)23-10-6-7-11-24(23)32(34)35/h3-11H,12-15,17-18H2,1-2H3,(H,28,33) |
| InChIKey | KWXJSKPXSQSQKF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|