C26H36N6O3 — CID 24507362
2-[4-[2-[(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 24507362) has the molecular formula C26H36N6O3 and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-[4-[2-[(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-[2-[(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 24507362 |
| Molecular Formula | C26H36N6O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 2-[4-[2-[(1-benzyl-3-cyano-4,5-dimethylpyrrol-2-yl)amino]-2-oxoethyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN1CCN(CC(=O)Nc2c(C#N)c(C)c(C)n2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H36N6O3/c1-20-21(2)32(17-22-8-5-4-6-9-22)26(23(20)16-27)29-25(34)19-31-13-11-30(12-14-31)18-24(33)28-10-7-15-35-3/h4-6,8-9H,7,10-15,17-19H2,1-3H3,(H,28,33)(H,29,34) |
| InChIKey | FSSBVMNJGAUPQS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 102.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|