C26H28N6O4 — CID 38065583
N-[3-cyano-1-(4-methoxyphenyl)-4,5-dimethylpyrrol-2-yl]-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide (PubChem CID 38065583) has the molecular formula C26H28N6O4 and a molecular weight of 488.55 g/mol. Its IUPAC name is N-[3-cyano-1-(4-methoxyphenyl)-4,5-dimethylpyrrol-2-yl]-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[3-cyano-1-(4-methoxyphenyl)-4,5-dimethylpyrrol-2-yl]-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 38065583 |
| Molecular Formula | C26H28N6O4 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | N-[3-cyano-1-(4-methoxyphenyl)-4,5-dimethylpyrrol-2-yl]-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide |
| SMILES | COc1ccc(-n2c(C)c(C)c(C#N)c2NC(=O)CN2CCN(c3ccccc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C26H28N6O4/c1-18-19(2)31(20-8-10-21(36-3)11-9-20)26(22(18)16-27)28-25(33)17-29-12-14-30(15-13-29)23-6-4-5-7-24(23)32(34)35/h4-11H,12-15,17H2,1-3H3,(H,28,33) |
| InChIKey | OLTIFROPHMJZND-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|