C21H18N4O4 — CID 16797412
N-(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)-2-(4-nitrophenoxy)acetamide (PubChem CID 16797412) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 16797412 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)-2-(4-nitrophenoxy)acetamide |
| SMILES | Cc1c(C#N)c(NC(=O)COc2ccc([N+](=O)[O-])cc2)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C21H18N4O4/c1-14-15(2)24(16-6-4-3-5-7-16)21(19(14)12-22)23-20(26)13-29-18-10-8-17(9-11-18)25(27)28/h3-11H,13H2,1-2H3,(H,23,26) |
| InChIKey | FUGUHAAUJQBMRX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|