C24H23N5O5 — CID 55487385
[2-[(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)amino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate (PubChem CID 55487385) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is [2-[(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)amino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate.
| Compound Name | [2-[(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)amino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 55487385 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | [2-[(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)amino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate |
| SMILES | Cc1c(C#N)c(NC(=O)COC(=O)c2cc([N+](=O)[O-])ccc2N(C)C)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C24H23N5O5/c1-15-16(2)28(17-8-6-5-7-9-17)23(20(15)13-25)26-22(30)14-34-24(31)19-12-18(29(32)33)10-11-21(19)27(3)4/h5-12H,14H2,1-4H3,(H,26,30) |
| InChIKey | NWZCRNGCMVPXNY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 130.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|