C21H17FN4O4 — CID 16797438
N-(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)-2-(5-fluoro-2-nitrophenoxy)acetamide (PubChem CID 16797438) has the molecular formula C21H17FN4O4 and a molecular weight of 408.39 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)-2-(5-fluoro-2-nitrophenoxy)acetamide.
| Compound Name | N-(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)-2-(5-fluoro-2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 16797438 |
| Molecular Formula | C21H17FN4O4 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)-2-(5-fluoro-2-nitrophenoxy)acetamide |
| SMILES | Cc1c(C#N)c(NC(=O)COc2cc(F)ccc2[N+](=O)[O-])n(-c2ccccc2)c1C |
| InChI | InChI=1S/C21H17FN4O4/c1-13-14(2)25(16-6-4-3-5-7-16)21(17(13)11-23)24-20(27)12-30-19-10-15(22)8-9-18(19)26(28)29/h3-10H,12H2,1-2H3,(H,24,27) |
| InChIKey | YPAZXEHONBMHSF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|