C16H15FN2O4 — CID 2690891
N-(2,3-dimethylphenyl)-2-(5-fluoro-2-nitrophenoxy)acetamide (PubChem CID 2690891) has the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(5-fluoro-2-nitrophenoxy)acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(5-fluoro-2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 2690891 |
| Molecular Formula | C16H15FN2O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(5-fluoro-2-nitrophenoxy)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2cc(F)ccc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C16H15FN2O4/c1-10-4-3-5-13(11(10)2)18-16(20)9-23-15-8-12(17)6-7-14(15)19(21)22/h3-8H,9H2,1-2H3,(H,18,20) |
| InChIKey | MRSYJWFFOYABSF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|