C18H15FN2O8 — CID 2690933
dimethyl 2-[[2-(5-fluoro-2-nitrophenoxy)acetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 2690933) has the molecular formula C18H15FN2O8 and a molecular weight of 406.32 g/mol. Its IUPAC name is dimethyl 2-[[2-(5-fluoro-2-nitrophenoxy)acetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(5-fluoro-2-nitrophenoxy)acetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 2690933 |
| Molecular Formula | C18H15FN2O8 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | dimethyl 2-[[2-(5-fluoro-2-nitrophenoxy)acetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)COc2cc(F)ccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15FN2O8/c1-27-17(23)10-3-5-12(18(24)28-2)13(7-10)20-16(22)9-29-15-8-11(19)4-6-14(15)21(25)26/h3-8H,9H2,1-2H3,(H,20,22) |
| InChIKey | LHLCHOSJQFNCOM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|